C17H18N3P — CID 146429697
[2-(3-ethyl-5-phenyl-1,2,4-triazol-4-yl)-3-methylphenyl]phosphane (PubChem CID 146429697) has the molecular formula C17H18N3P and a molecular weight of 295.33 g/mol. Its IUPAC name is [2-(3-ethyl-5-phenyl-1,2,4-triazol-4-yl)-3-methylphenyl]phosphane.
| Compound Name | [2-(3-ethyl-5-phenyl-1,2,4-triazol-4-yl)-3-methylphenyl]phosphane |
|---|---|
| PubChem CID | 146429697 |
| Molecular Formula | C17H18N3P |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(3-ethyl-5-phenyl-1,2,4-triazol-4-yl)-3-methylphenyl]phosphane |
| SMILES | CCc1nnc(-c2ccccc2)n1-c1c(C)cccc1P |
| InChI | InChI=1S/C17H18N3P/c1-3-15-18-19-17(13-9-5-4-6-10-13)20(15)16-12(2)8-7-11-14(16)21/h4-11H,3,21H2,1-2H3 |
| InChIKey | ZLSMNHQQHPYNOS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|