C47H45Cl2N5 — CID 172982965
(NZ,1Z)-N-[chloro(phenyl)methylidene]-2-methylbenzenecarbohydrazonoyl chloride;4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;1,2,3-trimethylbenzene (PubChem CID 172982965) has the molecular formula C47H45Cl2N5 and a molecular weight of 750.82 g/mol. Its IUPAC name is (NZ,1Z)-N-[chloro(phenyl)methylidene]-2-methylbenzenecarbohydrazonoyl chloride;4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;1,2,3-trimethylbenzene.
| Compound Name | (NZ,1Z)-N-[chloro(phenyl)methylidene]-2-methylbenzenecarbohydrazonoyl chloride;4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 172982965 |
| Molecular Formula | C47H45Cl2N5 |
| Molecular Weight | 750.82 g/mol |
| Exact Mass | 749.31 |
| IUPAC Name | (NZ,1Z)-N-[chloro(phenyl)methylidene]-2-methylbenzenecarbohydrazonoyl chloride;4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;1,2,3-trimethylbenzene |
| SMILES | Cc1cccc(C)c1C.Cc1ccccc1-c1nnc(-c2ccccc2)n1-c1c(C)cccc1C.Cc1ccccc1/C(Cl)=N/N=C(\Cl)c1ccccc1 |
| InChI | InChI=1S/C23H21N3.C15H12Cl2N2.C9H12/c1-16-10-7-8-15-20(16)23-25-24-22(19-13-5-4-6-14-19)26(23)21-17(2)11-9-12-18(21)3;1-11-7-5-6-10-13(11)15(17)19-18-14(16)12-8-3-2-4-9-12;1-7-5-4-6-8(2)9(7)3/h4-15H,1-3H3;2-10H,1H3;4-6H,1-3H3/b;18-14-,19-15-; |
| InChIKey | MNHFDCHWJTVJPY-GYHMILLBSA-N |
| XLogP | 12.72 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.82 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|