C14H10Cl2N2 — CID 6141172
(NE,E)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride (PubChem CID 6141172) has the molecular formula C14H10Cl2N2 and a molecular weight of 277.15 g/mol. Its IUPAC name is (NE,E)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride.
| Compound Name | (NE,E)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 6141172 |
| Molecular Formula | C14H10Cl2N2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (NE,E)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride |
| SMILES | Cl/C(=N/N=C(/Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2N2/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H/b17-13+,18-14+ |
| InChIKey | SAZIGIAVMOYTBU-HBKJEHTGSA-N |
| XLogP | 4.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|