About acetic acid;N-hydroxybenzenecarboximidoyl chloride
acetic acid;N-hydroxybenzenecarboximidoyl chloride (PubChem CID 158315171) has the molecular formula C9H10ClNO3
and a molecular weight of 215.64 g/mol. Its IUPAC name is acetic acid;N-hydroxybenzenecarboximidoyl chloride.
Molecular Properties
| Compound Name | acetic acid;N-hydroxybenzenecarboximidoyl chloride |
| PubChem CID | 158315171 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | acetic acid;N-hydroxybenzenecarboximidoyl chloride |
| SMILES | CC(=O)O.ON=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H6ClNO.C2H4O2/c8-7(9-10)6-4-2-1-3-5-6;1-2(3)4/h1-5,10H;1H3,(H,3,4) |
| InChIKey | GOEGVRFMXQDQOK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-hydroxybenzenecarboximidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-hydroxybenzenecarboximidoyl chloride?
The IUPAC name of acetic acid;N-hydroxybenzenecarboximidoyl chloride (CID 158315171) is acetic acid;N-hydroxybenzenecarboximidoyl chloride.
What is the SMILES notation for acetic acid;N-hydroxybenzenecarboximidoyl chloride?
The canonical SMILES for acetic acid;N-hydroxybenzenecarboximidoyl chloride is CC(=O)O.ON=C(Cl)c1ccccc1.
What is the InChIKey of acetic acid;N-hydroxybenzenecarboximidoyl chloride?
The InChIKey is GOEGVRFMXQDQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO.C2H4O2/c8-7(9-10)6-4-2-1-3-5-6;1-2(3)4/h1-5,10H;1H3,(H,3,4).
What are the key properties of acetic acid;N-hydroxybenzenecarboximidoyl chloride?
acetic acid;N-hydroxybenzenecarboximidoyl chloride has a molecular weight of 215.64 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-hydroxybenzenecarboximidoyl chloride is sourced from PubChem (CID 158315171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).