C47H45IrN3-2 — CID 166563942
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-[4-(1-deuteriocyclopentyl)phenyl]-2-phenylpyridine;iridium (PubChem CID 166563942) has the molecular formula C47H45IrN3-2 and a molecular weight of 847.13 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-[4-(1-deuteriocyclopentyl)phenyl]-2-phenylpyridine;iridium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-[4-(1-deuteriocyclopentyl)phenyl]-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 166563942 |
| Molecular Formula | C47H45IrN3-2 |
| Molecular Weight | 847.13 g/mol |
| Exact Mass | 847.34 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-[4-(1-deuteriocyclopentyl)phenyl]-2-phenylpyridine;iridium |
| SMILES | [2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[2H]C1(c2ccc(-c3ccnc(-c4[c-]cccc4)c3)cc2)CCCC1.[Ir] |
| InChI | InChI=1S/C25H25N2.C22H20N.Ir/c1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;1-2-8-20(9-3-1)22-16-21(14-15-23-22)19-12-10-18(11-13-19)17-6-4-5-7-17;/h5-11,13-18H,1-4H3;1-3,8,10-17H,4-7H2;/q2*-1;/i17D,18D;17D; |
| InChIKey | AXOOJXCKWGGZAN-BJEMTXDESA-N |
| XLogP | 12.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.13 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|