C16H21N3O — CID 115395849
[5-(cyclohexylmethyl)-4-phenyl-1,2,4-triazol-3-yl]methanol (PubChem CID 115395849) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-4-phenyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(cyclohexylmethyl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115395849 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | [5-(cyclohexylmethyl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1nnc(CC2CCCCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C16H21N3O/c20-12-16-18-17-15(11-13-7-3-1-4-8-13)19(16)14-9-5-2-6-10-14/h2,5-6,9-10,13,20H,1,3-4,7-8,11-12H2 |
| InChIKey | UZBRCIPOKLQEFN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |