C14H17N3O2 — CID 115395856
[5-(oxan-4-yl)-4-phenyl-1,2,4-triazol-3-yl]methanol (PubChem CID 115395856) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is [5-(oxan-4-yl)-4-phenyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(oxan-4-yl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115395856 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | [5-(oxan-4-yl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1nnc(C2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C14H17N3O2/c18-10-13-15-16-14(11-6-8-19-9-7-11)17(13)12-4-2-1-3-5-12/h1-5,11,18H,6-10H2 |
| InChIKey | GLIGWUYZWAAHFQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |