C21H29N5O — CID 155607964
1-cyclohexyl-3-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]urea (PubChem CID 155607964) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]urea.
| Compound Name | 1-cyclohexyl-3-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]urea |
|---|---|
| PubChem CID | 155607964 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-cyclohexyl-3-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]urea |
| SMILES | O=C(NCCCc1nnc(C2CC2)n1-c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C21H29N5O/c27-21(23-17-8-3-1-4-9-17)22-15-7-12-19-24-25-20(16-13-14-16)26(19)18-10-5-2-6-11-18/h2,5-6,10-11,16-17H,1,3-4,7-9,12-15H2,(H2,22,23,27) |
| InChIKey | WZSFNGBTEGDXLK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|