C25H26IrN3O2- — CID 59512739
4,5-diphenyl-3-phenyl-1,2,4-triazole;iridium;pentane-2,4-diol (PubChem CID 59512739) has the molecular formula C25H26IrN3O2- and a molecular weight of 592.72 g/mol. Its IUPAC name is 4,5-diphenyl-3-phenyl-1,2,4-triazole;iridium;pentane-2,4-diol.
| Compound Name | 4,5-diphenyl-3-phenyl-1,2,4-triazole;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 59512739 |
| Molecular Formula | C25H26IrN3O2- |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 4,5-diphenyl-3-phenyl-1,2,4-triazole;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1ccccc1-c1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H14N3.C5H12O2.Ir/c1-4-10-16(11-5-1)19-21-22-20(17-12-6-2-7-13-17)23(19)18-14-8-3-9-15-18;1-4(6)3-5(2)7;/h1-12,14-15H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | GJVKHQQRJGKAGT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|