C28H30IrN3O4- — CID 59512734
ethyl 3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)benzoate;iridium;pentane-2,4-diol (PubChem CID 59512734) has the molecular formula C28H30IrN3O4- and a molecular weight of 664.78 g/mol. Its IUPAC name is ethyl 3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)benzoate;iridium;pentane-2,4-diol.
| Compound Name | ethyl 3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)benzoate;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 59512734 |
| Molecular Formula | C28H30IrN3O4- |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | ethyl 3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)benzoate;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.CCOC(=O)c1cccc(-n2c(-c3[c-]cccc3)nnc2-c2ccccc2)c1.[Ir] |
| InChI | InChI=1S/C23H18N3O2.C5H12O2.Ir/c1-2-28-23(27)19-14-9-15-20(16-19)26-21(17-10-5-3-6-11-17)24-25-22(26)18-12-7-4-8-13-18;1-4(6)3-5(2)7;/h3-12,14-16H,2H2,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | CSFNBLYTQDBPNH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|