C24H25IrN4O2- — CID 59512716
iridium;pentane-2,4-diol;3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)pyridine (PubChem CID 59512716) has the molecular formula C24H25IrN4O2- and a molecular weight of 593.71 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)pyridine.
| Compound Name | iridium;pentane-2,4-diol;3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)pyridine |
|---|---|
| PubChem CID | 59512716 |
| Molecular Formula | C24H25IrN4O2- |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | iridium;pentane-2,4-diol;3-(5-phenyl-3-phenyl-1,2,4-triazol-4-yl)pyridine |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1ccccc1-c1nnc(-c2ccccc2)n1-c1cccnc1 |
| InChI | InChI=1S/C19H13N4.C5H12O2.Ir/c1-3-8-15(9-4-1)18-21-22-19(16-10-5-2-6-11-16)23(18)17-12-7-13-20-14-17;1-4(6)3-5(2)7;/h1-10,12-14H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | PLZXIQQVCQEYKM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|