C14H11IrN4- — CID 58068032
iridium;3-(5-methyl-4-phenyl-1,2,4-triazol-3-yl)-4H-pyridin-4-ide (PubChem CID 58068032) has the molecular formula C14H11IrN4- and a molecular weight of 427.49 g/mol. Its IUPAC name is iridium;3-(5-methyl-4-phenyl-1,2,4-triazol-3-yl)-4H-pyridin-4-ide.
| Compound Name | iridium;3-(5-methyl-4-phenyl-1,2,4-triazol-3-yl)-4H-pyridin-4-ide |
|---|---|
| PubChem CID | 58068032 |
| Molecular Formula | C14H11IrN4- |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | iridium;3-(5-methyl-4-phenyl-1,2,4-triazol-3-yl)-4H-pyridin-4-ide |
| SMILES | Cc1nnc(-c2[c-]ccnc2)n1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C14H11N4.Ir/c1-11-16-17-14(12-6-5-9-15-10-12)18(11)13-7-3-2-4-8-13;/h2-5,7-10H,1H3;/q-1; |
| InChIKey | QPXBCZFSPYUBLH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|