C23H29N3O2 — CID 4975526
2-cyclohexyl-10-methyl-3-pentylpyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 4975526) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-cyclohexyl-10-methyl-3-pentylpyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 2-cyclohexyl-10-methyl-3-pentylpyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 4975526 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-cyclohexyl-10-methyl-3-pentylpyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | CCCCCn1c(C2CCCCC2)nc2c(c(=O)c3ccccc3n2C)c1=O |
| InChI | InChI=1S/C23H29N3O2/c1-3-4-10-15-26-21(16-11-6-5-7-12-16)24-22-19(23(26)28)20(27)17-13-8-9-14-18(17)25(22)2/h8-9,13-14,16H,3-7,10-12,15H2,1-2H3 |
| InChIKey | AQUIYYNEZMJQLD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|