C21H19N3O2 — CID 7660271
3-benzyl-2-ethyl-10-methylpyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 7660271) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-benzyl-2-ethyl-10-methylpyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 3-benzyl-2-ethyl-10-methylpyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 7660271 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-benzyl-2-ethyl-10-methylpyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | CCc1nc2c(c(=O)c3ccccc3n2C)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H19N3O2/c1-3-17-22-20-18(19(25)15-11-7-8-12-16(15)23(20)2)21(26)24(17)13-14-9-5-4-6-10-14/h4-12H,3,13H2,1-2H3 |
| InChIKey | CFHOFIDUNPCCKG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|