C19H14N2O2S — CID 4860361
2-ethyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 4860361) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-ethyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 2-ethyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 4860361 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-ethyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | CCc1nc2sc3ccccc3c(=O)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C19H14N2O2S/c1-2-15-20-18-16(17(22)13-10-6-7-11-14(13)24-18)19(23)21(15)12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | ULANEJVFTIGDHB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|