C15H11N3O2 — CID 145057452
6-ethyl-3-ethynyl-5-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one (PubChem CID 145057452) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 6-ethyl-3-ethynyl-5-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-3-ethynyl-5-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145057452 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6-ethyl-3-ethynyl-5-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| SMILES | C#Cc1noc2nc(CC)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C15H11N3O2/c1-3-11-13-14(20-17-11)16-12(4-2)18(15(13)19)10-8-6-5-7-9-10/h1,5-9H,4H2,2H3 |
| InChIKey | IANRCRFGYVYYLR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|