C23H19N3OS — CID 144824878
5-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one (PubChem CID 144824878) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one.
| Compound Name | 5-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144824878 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 5-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one |
| SMILES | CCc1nc2cccc(C#Cc3sc(C)nc3C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H19N3OS/c1-4-21-25-19-12-8-9-17(13-14-20-15(2)24-16(3)28-20)22(19)23(27)26(21)18-10-6-5-7-11-18/h5-12H,4H2,1-3H3 |
| InChIKey | BHYZXTHBSNVNMI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|