C23H20N4O — CID 123948593
5-[2-(1,5-dimethylpyrazol-4-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one (PubChem CID 123948593) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-[2-(1,5-dimethylpyrazol-4-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one.
| Compound Name | 5-[2-(1,5-dimethylpyrazol-4-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 123948593 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-[2-(1,5-dimethylpyrazol-4-yl)ethynyl]-2-ethyl-3-phenylquinazolin-4-one |
| SMILES | CCc1nc2cccc(C#Cc3cnn(C)c3C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O/c1-4-21-25-20-12-8-9-17(13-14-18-15-24-26(3)16(18)2)22(20)23(28)27(21)19-10-6-5-7-11-19/h5-12,15H,4H2,1-3H3 |
| InChIKey | RPCUKGGOFCJSRO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|