C31H25N7O2 — CID 144824937
2-ethyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]-3-phenylquinazolin-4-one;1,6-naphthyridine-8-carboxamide (PubChem CID 144824937) has the molecular formula C31H25N7O2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-ethyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]-3-phenylquinazolin-4-one;1,6-naphthyridine-8-carboxamide.
| Compound Name | 2-ethyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]-3-phenylquinazolin-4-one;1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 144824937 |
| Molecular Formula | C31H25N7O2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-ethyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]-3-phenylquinazolin-4-one;1,6-naphthyridine-8-carboxamide |
| SMILES | CCc1nc2cccc(C#Cc3cnn(C)c3)c2c(=O)n1-c1ccccc1.NC(=O)c1cncc2cccnc12 |
| InChI | InChI=1S/C22H18N4O.C9H7N3O/c1-3-20-24-19-11-7-8-17(13-12-16-14-23-25(2)15-16)21(19)22(27)26(20)18-9-5-4-6-10-18;10-9(13)7-5-11-4-6-2-1-3-12-8(6)7/h4-11,14-15H,3H2,1-2H3;1-5H,(H2,10,13) |
| InChIKey | ULFJKNAEXMRSGW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|