C21H19NO — CID 144824176
8-but-1-ynyl-3-ethyl-2-phenylisoquinolin-1-one (PubChem CID 144824176) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is 8-but-1-ynyl-3-ethyl-2-phenylisoquinolin-1-one.
| Compound Name | 8-but-1-ynyl-3-ethyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144824176 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 8-but-1-ynyl-3-ethyl-2-phenylisoquinolin-1-one |
| SMILES | CCC#Cc1cccc2cc(CC)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C21H19NO/c1-3-5-10-16-11-9-12-17-15-18(4-2)22(21(23)20(16)17)19-13-7-6-8-14-19/h6-9,11-15H,3-4H2,1-2H3 |
| InChIKey | MNURURURBCVPMI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|