C25H20N2O2 — CID 144824443
3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one (PubChem CID 144824443) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one.
| Compound Name | 3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144824443 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(C#Cc3ccnc(OC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2/c1-3-21-17-20-9-7-8-19(13-12-18-14-15-26-23(16-18)29-2)24(20)25(28)27(21)22-10-5-4-6-11-22/h4-11,14-17H,3H2,1-2H3 |
| InChIKey | GNWTUHVIWDYELX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|