C23H23NO — CID 144824598
8-(3,3-dimethylbut-1-ynyl)-3-ethyl-2-phenylisoquinolin-1-one (PubChem CID 144824598) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 8-(3,3-dimethylbut-1-ynyl)-3-ethyl-2-phenylisoquinolin-1-one.
| Compound Name | 8-(3,3-dimethylbut-1-ynyl)-3-ethyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144824598 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 8-(3,3-dimethylbut-1-ynyl)-3-ethyl-2-phenylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(C#CC(C)(C)C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c1-5-19-16-18-11-9-10-17(14-15-23(2,3)4)21(18)22(25)24(19)20-12-7-6-8-13-20/h6-13,16H,5H2,1-4H3 |
| InChIKey | CVRNOPMXGRJMFJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|