C25H22N2O4 — CID 144825011
N-[3-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)prop-2-ynyl]-5-oxooxolane-2-carboxamide (PubChem CID 144825011) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[3-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)prop-2-ynyl]-5-oxooxolane-2-carboxamide.
| Compound Name | N-[3-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)prop-2-ynyl]-5-oxooxolane-2-carboxamide |
|---|---|
| PubChem CID | 144825011 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[3-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)prop-2-ynyl]-5-oxooxolane-2-carboxamide |
| SMILES | CCc1cc2cccc(C#CCNC(=O)C3CCC(=O)O3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H22N2O4/c1-2-19-16-18-9-6-8-17(10-7-15-26-24(29)21-13-14-22(28)31-21)23(18)25(30)27(19)20-11-4-3-5-12-20/h3-6,8-9,11-12,16,21H,2,13-15H2,1H3,(H,26,29) |
| InChIKey | DLZSFRHNMPNODY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|