C33H31N7O3 — CID 144824442
3-amino-1-methyl-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide;3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one (PubChem CID 144824442) has the molecular formula C33H31N7O3 and a molecular weight of 573.66 g/mol. Its IUPAC name is 3-amino-1-methyl-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide;3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one.
| Compound Name | 3-amino-1-methyl-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide;3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144824442 |
| Molecular Formula | C33H31N7O3 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 3-amino-1-methyl-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide;3-ethyl-8-[2-(2-methoxy-4-pyridinyl)ethynyl]-2-phenylisoquinolin-1-one |
| SMILES | C=C/C=N\c1c(C(N)=O)c(N)nn1C.CCc1cc2cccc(C#Cc3ccnc(OC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2.C8H11N5O/c1-3-21-17-20-9-7-8-19(13-12-18-14-15-26-23(16-18)29-2)24(20)25(28)27(21)22-10-5-4-6-11-22;1-3-4-11-8-5(7(10)14)6(9)12-13(8)2/h4-11,14-17H,3H2,1-2H3;3-4H,1H2,2H3,(H2,9,12)(H2,10,14)/b;11-4- |
| InChIKey | NCDYTHPVHYWYEZ-AEQRBJNFSA-N |
| XLogP | 4.35 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|