C32H36N6O2 — CID 144927141
3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclopentylethynyl)-3-ethyl-2-phenylisoquinolin-1-one (PubChem CID 144927141) has the molecular formula C32H36N6O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclopentylethynyl)-3-ethyl-2-phenylisoquinolin-1-one.
| Compound Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclopentylethynyl)-3-ethyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144927141 |
| Molecular Formula | C32H36N6O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclopentylethynyl)-3-ethyl-2-phenylisoquinolin-1-one |
| SMILES | C=CCNc1c(C(N)=O)c(N)nn1C.CCc1cc2cccc(C#CC3CCCC3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H23NO.C8H13N5O/c1-2-21-17-20-12-8-11-19(16-15-18-9-6-7-10-18)23(20)24(26)25(21)22-13-4-3-5-14-22;1-3-4-11-8-5(7(10)14)6(9)12-13(8)2/h3-5,8,11-14,17-18H,2,6-7,9-10H2,1H3;3,11H,1,4H2,2H3,(H2,9,12)(H2,10,14) |
| InChIKey | GCALWZPPLUSCPS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|