C31H29N7O3 — CID 144824934
2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;N-[4-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)but-3-ynyl]prop-2-enamide (PubChem CID 144824934) has the molecular formula C31H29N7O3 and a molecular weight of 547.62 g/mol. Its IUPAC name is 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;N-[4-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)but-3-ynyl]prop-2-enamide.
| Compound Name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;N-[4-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)but-3-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 144824934 |
| Molecular Formula | C31H29N7O3 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;N-[4-(3-ethyl-1-oxo-2-phenylisoquinolin-8-yl)but-3-ynyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC#Cc1cccc2cc(CC)n(-c3ccccc3)c(=O)c12.NC(=O)c1c(N)nn2cccnc12 |
| InChI | InChI=1S/C24H22N2O2.C7H7N5O/c1-3-20-17-19-13-10-12-18(11-8-9-16-25-22(27)4-2)23(19)24(28)26(20)21-14-6-5-7-15-21;8-5-4(6(9)13)7-10-2-1-3-12(7)11-5/h4-7,10,12-15,17H,2-3,9,16H2,1H3,(H,25,27);1-3H,(H2,8,11)(H2,9,13) |
| InChIKey | RACSTOBJYYHMFH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 150.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|