C28H27N7O3 — CID 144926830
3-aminopyrazine-2-carboxamide;N-[4-(2-ethyl-4-oxo-3-phenylquinazolin-5-yl)but-3-ynyl]prop-2-enamide (PubChem CID 144926830) has the molecular formula C28H27N7O3 and a molecular weight of 509.57 g/mol. Its IUPAC name is 3-aminopyrazine-2-carboxamide;N-[4-(2-ethyl-4-oxo-3-phenylquinazolin-5-yl)but-3-ynyl]prop-2-enamide.
| Compound Name | 3-aminopyrazine-2-carboxamide;N-[4-(2-ethyl-4-oxo-3-phenylquinazolin-5-yl)but-3-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 144926830 |
| Molecular Formula | C28H27N7O3 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 3-aminopyrazine-2-carboxamide;N-[4-(2-ethyl-4-oxo-3-phenylquinazolin-5-yl)but-3-ynyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC#Cc1cccc2nc(CC)n(-c3ccccc3)c(=O)c12.NC(=O)c1nccnc1N |
| InChI | InChI=1S/C23H21N3O2.C5H6N4O/c1-3-20-25-19-15-10-12-17(11-8-9-16-24-21(27)4-2)22(19)23(28)26(20)18-13-6-5-7-14-18;6-4-3(5(7)10)8-1-2-9-4/h4-7,10,12-15H,2-3,9,16H2,1H3,(H,24,27);1-2H,(H2,6,9)(H2,7,10) |
| InChIKey | ZRDWCTYOORGROM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|