C32H31N7O3 — CID 159101021
2-amino-N-[(1S)-1-[1-oxo-2-phenyl-8-[4-(prop-2-enoylamino)but-1-ynyl]isoquinolin-3-yl]ethyl]imidazo[1,2-b]pyridazine-3-carboxamide;methane (PubChem CID 159101021) has the molecular formula C32H31N7O3 and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-amino-N-[(1S)-1-[1-oxo-2-phenyl-8-[4-(prop-2-enoylamino)but-1-ynyl]isoquinolin-3-yl]ethyl]imidazo[1,2-b]pyridazine-3-carboxamide;methane.
| Compound Name | 2-amino-N-[(1S)-1-[1-oxo-2-phenyl-8-[4-(prop-2-enoylamino)but-1-ynyl]isoquinolin-3-yl]ethyl]imidazo[1,2-b]pyridazine-3-carboxamide;methane |
|---|---|
| PubChem CID | 159101021 |
| Molecular Formula | C32H31N7O3 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-amino-N-[(1S)-1-[1-oxo-2-phenyl-8-[4-(prop-2-enoylamino)but-1-ynyl]isoquinolin-3-yl]ethyl]imidazo[1,2-b]pyridazine-3-carboxamide;methane |
| SMILES | C.C=CC(=O)NCCC#Cc1cccc2cc([C@H](C)NC(=O)c3c(N)nc4cccnn34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C31H27N7O3.CH4/c1-3-26(39)33-17-8-7-11-21-12-9-13-22-19-24(37(31(41)27(21)22)23-14-5-4-6-15-23)20(2)35-30(40)28-29(32)36-25-16-10-18-34-38(25)28;/h3-6,9-10,12-16,18-20H,1,8,17,32H2,2H3,(H,33,39)(H,35,40);1H4/t20-;/m0./s1 |
| InChIKey | KDGZTLNXGJPZSL-BDQAORGHSA-N |
| XLogP | 3.79 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|