C30H30N8O2S — CID 144926706
3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;2-ethyl-5-[2-(4-methyl-1,3-thiazol-2-yl)ethynyl]-3-phenylquinazolin-4-one (PubChem CID 144926706) has the molecular formula C30H30N8O2S and a molecular weight of 566.69 g/mol. Its IUPAC name is 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;2-ethyl-5-[2-(4-methyl-1,3-thiazol-2-yl)ethynyl]-3-phenylquinazolin-4-one.
| Compound Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;2-ethyl-5-[2-(4-methyl-1,3-thiazol-2-yl)ethynyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144926706 |
| Molecular Formula | C30H30N8O2S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;2-ethyl-5-[2-(4-methyl-1,3-thiazol-2-yl)ethynyl]-3-phenylquinazolin-4-one |
| SMILES | C=CCNc1c(C(N)=O)c(N)nn1C.CCc1nc2cccc(C#Cc3nc(C)cs3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H17N3OS.C8H13N5O/c1-3-19-24-18-11-7-8-16(12-13-20-23-15(2)14-27-20)21(18)22(26)25(19)17-9-5-4-6-10-17;1-3-4-11-8-5(7(10)14)6(9)12-13(8)2/h4-11,14H,3H2,1-2H3;3,11H,1,4H2,2H3,(H2,9,12)(H2,10,14) |
| InChIKey | ROSARMLTAWKTSM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|