C28H25F3N6O2 — CID 144926616
3-amino-1-methyl-N-[1-[1-oxo-2-phenyl-8-(3,3,3-trifluoroprop-1-ynyl)isoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide (PubChem CID 144926616) has the molecular formula C28H25F3N6O2 and a molecular weight of 534.54 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[1-[1-oxo-2-phenyl-8-(3,3,3-trifluoroprop-1-ynyl)isoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[1-[1-oxo-2-phenyl-8-(3,3,3-trifluoroprop-1-ynyl)isoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144926616 |
| Molecular Formula | C28H25F3N6O2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 3-amino-1-methyl-N-[1-[1-oxo-2-phenyl-8-(3,3,3-trifluoroprop-1-ynyl)isoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
| SMILES | C=CCNc1c(C(=O)NC(C)c2cc3cccc(C#CC(F)(F)F)c3c(=O)n2-c2ccccc2)c(N)nn1C |
| InChI | InChI=1S/C28H25F3N6O2/c1-4-15-33-25-23(24(32)35-36(25)3)26(38)34-17(2)21-16-19-10-8-9-18(13-14-28(29,30)31)22(19)27(39)37(21)20-11-6-5-7-12-20/h4-12,16-17,33H,1,15H2,2-3H3,(H2,32,35)(H,34,38) |
| InChIKey | AZEJOLUNQFQKFS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|