C30H32N6O2 — CID 144926864
3-amino-1-methyl-N-[1-[8-(3-methylbut-1-ynyl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide (PubChem CID 144926864) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[1-[8-(3-methylbut-1-ynyl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[1-[8-(3-methylbut-1-ynyl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144926864 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 3-amino-1-methyl-N-[1-[8-(3-methylbut-1-ynyl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
| SMILES | C=CCNc1c(C(=O)NC(C)c2cc3cccc(C#CC(C)C)c3c(=O)n2-c2ccccc2)c(N)nn1C |
| InChI | InChI=1S/C30H32N6O2/c1-6-17-32-28-26(27(31)34-35(28)5)29(37)33-20(4)24-18-22-12-10-11-21(16-15-19(2)3)25(22)30(38)36(24)23-13-8-7-9-14-23/h6-14,18-20,32H,1,17H2,2-5H3,(H2,31,34)(H,33,37) |
| InChIKey | SJICAQUKSUPSOX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|