C31H28N8O3 — CID 144824505
3-amino-1-methyl-N-[1-[4-oxo-5-[2-(2-oxo-1H-pyridin-4-yl)ethynyl]-3-phenylquinazolin-2-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide (PubChem CID 144824505) has the molecular formula C31H28N8O3 and a molecular weight of 560.62 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[1-[4-oxo-5-[2-(2-oxo-1H-pyridin-4-yl)ethynyl]-3-phenylquinazolin-2-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[1-[4-oxo-5-[2-(2-oxo-1H-pyridin-4-yl)ethynyl]-3-phenylquinazolin-2-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144824505 |
| Molecular Formula | C31H28N8O3 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3-amino-1-methyl-N-[1-[4-oxo-5-[2-(2-oxo-1H-pyridin-4-yl)ethynyl]-3-phenylquinazolin-2-yl]ethyl]-5-(prop-2-enylamino)pyrazole-4-carboxamide |
| SMILES | C=CCNc1c(C(=O)NC(C)c2nc3cccc(C#Cc4cc[nH]c(=O)c4)c3c(=O)n2-c2ccccc2)c(N)nn1C |
| InChI | InChI=1S/C31H28N8O3/c1-4-16-34-29-26(27(32)37-38(29)3)30(41)35-19(2)28-36-23-12-8-9-21(14-13-20-15-17-33-24(40)18-20)25(23)31(42)39(28)22-10-6-5-7-11-22/h4-12,15,17-19,34H,1,16H2,2-3H3,(H2,32,37)(H,33,40)(H,35,41) |
| InChIKey | OFHNFFVPVPRNDW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|