C32H27N7O2 — CID 144926618
3-amino-1-methyl-N-[1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide (PubChem CID 144926618) has the molecular formula C32H27N7O2 and a molecular weight of 541.62 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144926618 |
| Molecular Formula | C32H27N7O2 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 3-amino-1-methyl-N-[1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-5-[(Z)-prop-2-enylideneamino]pyrazole-4-carboxamide |
| SMILES | C=C/C=N\c1c(C(=O)NC(C)c2nc3cccc(C#Cc4ccccc4)c3c(=O)n2-c2ccccc2)c(N)nn1C |
| InChI | InChI=1S/C32H27N7O2/c1-4-20-34-30-27(28(33)37-38(30)3)31(40)35-21(2)29-36-25-17-11-14-23(19-18-22-12-7-5-8-13-22)26(25)32(41)39(29)24-15-9-6-10-16-24/h4-17,20-21H,1H2,2-3H3,(H2,33,37)(H,35,40)/b34-20- |
| InChIKey | OCCCZSYNBXSDJG-GXBUFBABSA-N |
| XLogP | 4.48 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|