C29H34N8O2 — CID 144926715
5-(3-aminobut-1-ynyl)-2-[1-(methylamino)ethyl]-3-phenylquinazolin-4-one;3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carbaldehyde (PubChem CID 144926715) has the molecular formula C29H34N8O2 and a molecular weight of 526.65 g/mol. Its IUPAC name is 5-(3-aminobut-1-ynyl)-2-[1-(methylamino)ethyl]-3-phenylquinazolin-4-one;3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carbaldehyde.
| Compound Name | 5-(3-aminobut-1-ynyl)-2-[1-(methylamino)ethyl]-3-phenylquinazolin-4-one;3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 144926715 |
| Molecular Formula | C29H34N8O2 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 5-(3-aminobut-1-ynyl)-2-[1-(methylamino)ethyl]-3-phenylquinazolin-4-one;3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carbaldehyde |
| SMILES | C=CCNc1c(C=O)c(N)nn1C.CNC(C)c1nc2cccc(C#CC(C)N)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O.C8H12N4O/c1-14(22)12-13-16-8-7-11-18-19(16)21(26)25(17-9-5-4-6-10-17)20(24-18)15(2)23-3;1-3-4-10-8-6(5-13)7(9)11-12(8)2/h4-11,14-15,23H,22H2,1-3H3;3,5,10H,1,4H2,2H3,(H2,9,11) |
| InChIKey | ZZOYUFJGCGGEED-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|