C33H38N6O2 — CID 144926622
3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclohexylethynyl)-3-ethyl-2-phenylisoquinolin-1-one (PubChem CID 144926622) has the molecular formula C33H38N6O2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclohexylethynyl)-3-ethyl-2-phenylisoquinolin-1-one.
| Compound Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclohexylethynyl)-3-ethyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144926622 |
| Molecular Formula | C33H38N6O2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 3-amino-1-methyl-5-(prop-2-enylamino)pyrazole-4-carboxamide;8-(2-cyclohexylethynyl)-3-ethyl-2-phenylisoquinolin-1-one |
| SMILES | C=CCNc1c(C(N)=O)c(N)nn1C.CCc1cc2cccc(C#CC3CCCCC3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H25NO.C8H13N5O/c1-2-22-18-21-13-9-12-20(17-16-19-10-5-3-6-11-19)24(21)25(27)26(22)23-14-7-4-8-15-23;1-3-4-11-8-5(7(10)14)6(9)12-13(8)2/h4,7-9,12-15,18-19H,2-3,5-6,10-11H2,1H3;3,11H,1,4H2,2H3,(H2,9,12)(H2,10,14) |
| InChIKey | IBUCAGKNEATXMT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|