C21H19ClN6O2 — CID 144824068
3-aminopyrazine-2-carboxamide;5-chloro-2-ethyl-3-phenylquinazolin-4-one (PubChem CID 144824068) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 3-aminopyrazine-2-carboxamide;5-chloro-2-ethyl-3-phenylquinazolin-4-one.
| Compound Name | 3-aminopyrazine-2-carboxamide;5-chloro-2-ethyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144824068 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-aminopyrazine-2-carboxamide;5-chloro-2-ethyl-3-phenylquinazolin-4-one |
| SMILES | CCc1nc2cccc(Cl)c2c(=O)n1-c1ccccc1.NC(=O)c1nccnc1N |
| InChI | InChI=1S/C16H13ClN2O.C5H6N4O/c1-2-14-18-13-10-6-9-12(17)15(13)16(20)19(14)11-7-4-3-5-8-11;6-4-3(5(7)10)8-1-2-9-4/h3-10H,2H2,1H3;1-2H,(H2,6,9)(H2,7,10) |
| InChIKey | PBJWZZHFKBGICB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |