C22H18ClN5O2 — CID 145017894
2-[(2R)-4-(3-aminopyrazin-2-yl)-4-oxobutan-2-yl]-5-chloro-3-phenylquinazolin-4-one (PubChem CID 145017894) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-[(2R)-4-(3-aminopyrazin-2-yl)-4-oxobutan-2-yl]-5-chloro-3-phenylquinazolin-4-one.
| Compound Name | 2-[(2R)-4-(3-aminopyrazin-2-yl)-4-oxobutan-2-yl]-5-chloro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 145017894 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-[(2R)-4-(3-aminopyrazin-2-yl)-4-oxobutan-2-yl]-5-chloro-3-phenylquinazolin-4-one |
| SMILES | C[C@H](CC(=O)c1nccnc1N)c1nc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H18ClN5O2/c1-13(12-17(29)19-20(24)26-11-10-25-19)21-27-16-9-5-8-15(23)18(16)22(30)28(21)14-6-3-2-4-7-14/h2-11,13H,12H2,1H3,(H2,24,26)/t13-/m1/s1 |
| InChIKey | WUODXDASKRPSFR-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |