C15H12ClN3O2 — CID 155453969
5-chloro-2-[(1R)-1-hydroxyethyl]-3-pyridin-3-ylquinazolin-4-one (PubChem CID 155453969) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is 5-chloro-2-[(1R)-1-hydroxyethyl]-3-pyridin-3-ylquinazolin-4-one.
| Compound Name | 5-chloro-2-[(1R)-1-hydroxyethyl]-3-pyridin-3-ylquinazolin-4-one |
|---|---|
| PubChem CID | 155453969 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-chloro-2-[(1R)-1-hydroxyethyl]-3-pyridin-3-ylquinazolin-4-one |
| SMILES | C[C@@H](O)c1nc2cccc(Cl)c2c(=O)n1-c1cccnc1 |
| InChI | InChI=1S/C15H12ClN3O2/c1-9(20)14-18-12-6-2-5-11(16)13(12)15(21)19(14)10-4-3-7-17-8-10/h2-9,20H,1H3/t9-/m1/s1 |
| InChIKey | OOUNGYACVBWKCM-SECBINFHSA-N |
| XLogP | 2.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |