C23H26ClN3O3 — CID 166666957
tert-butyl-[(1R)-1-(5-chloro-4-oxo-3-phenylquinazolin-2-yl)-2-methylpropyl]carbamic acid (PubChem CID 166666957) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-(5-chloro-4-oxo-3-phenylquinazolin-2-yl)-2-methylpropyl]carbamic acid.
| Compound Name | tert-butyl-[(1R)-1-(5-chloro-4-oxo-3-phenylquinazolin-2-yl)-2-methylpropyl]carbamic acid |
|---|---|
| PubChem CID | 166666957 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl-[(1R)-1-(5-chloro-4-oxo-3-phenylquinazolin-2-yl)-2-methylpropyl]carbamic acid |
| SMILES | CC(C)[C@H](c1nc2cccc(Cl)c2c(=O)n1-c1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C23H26ClN3O3/c1-14(2)19(27(22(29)30)23(3,4)5)20-25-17-13-9-12-16(24)18(17)21(28)26(20)15-10-7-6-8-11-15/h6-14,19H,1-5H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | KGFXYUBATVJEGA-LJQANCHMSA-N |
| XLogP | 5.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |