C23H27ClN4O5S — CID 118276348
2-[1-[tert-butyl(carboxy)amino]ethyl]-5-chloro-4-oxo-3-[3-[1-(sulfinoamino)ethyl]phenyl]quinazoline (PubChem CID 118276348) has the molecular formula C23H27ClN4O5S and a molecular weight of 507.01 g/mol. Its IUPAC name is 2-[1-[tert-butyl(carboxy)amino]ethyl]-5-chloro-4-oxo-3-[3-[1-(sulfinoamino)ethyl]phenyl]quinazoline.
| Compound Name | 2-[1-[tert-butyl(carboxy)amino]ethyl]-5-chloro-4-oxo-3-[3-[1-(sulfinoamino)ethyl]phenyl]quinazoline |
|---|---|
| PubChem CID | 118276348 |
| Molecular Formula | C23H27ClN4O5S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-[1-[tert-butyl(carboxy)amino]ethyl]-5-chloro-4-oxo-3-[3-[1-(sulfinoamino)ethyl]phenyl]quinazoline |
| SMILES | CC(NS(=O)O)c1cccc(-n2c(C(C)N(C(=O)O)C(C)(C)C)nc3cccc(Cl)c3c2=O)c1 |
| InChI | InChI=1S/C23H27ClN4O5S/c1-13(26-34(32)33)15-8-6-9-16(12-15)27-20(14(2)28(22(30)31)23(3,4)5)25-18-11-7-10-17(24)19(18)21(27)29/h6-14,26H,1-5H3,(H,30,31)(H,32,33) |
| InChIKey | WIVPXOPLGONGFY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|