C25H30ClN3O3 — CID 90236686
tert-butyl-[1-[3-(3-butylphenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]carbamic acid (PubChem CID 90236686) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is tert-butyl-[1-[3-(3-butylphenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[3-(3-butylphenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 90236686 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | tert-butyl-[1-[3-(3-butylphenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
| SMILES | CCCCc1cccc(-n2c(C(C)N(C(=O)O)C(C)(C)C)nc3cccc(Cl)c3c2=O)c1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-6-7-10-17-11-8-12-18(15-17)28-22(16(2)29(24(31)32)25(3,4)5)27-20-14-9-13-19(26)21(20)23(28)30/h8-9,11-16H,6-7,10H2,1-5H3,(H,31,32) |
| InChIKey | QAIYLCFWYMPMSO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |