C21H22Cl2N4O3 — CID 118571369
[(1S)-1-[3-(3-aminophenyl)-5,8-dichloro-4-oxoquinazolin-2-yl]ethyl]-tert-butylcarbamic acid (PubChem CID 118571369) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is [(1S)-1-[3-(3-aminophenyl)-5,8-dichloro-4-oxoquinazolin-2-yl]ethyl]-tert-butylcarbamic acid.
| Compound Name | [(1S)-1-[3-(3-aminophenyl)-5,8-dichloro-4-oxoquinazolin-2-yl]ethyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118571369 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [(1S)-1-[3-(3-aminophenyl)-5,8-dichloro-4-oxoquinazolin-2-yl]ethyl]-tert-butylcarbamic acid |
| SMILES | C[C@@H](c1nc2c(Cl)ccc(Cl)c2c(=O)n1-c1cccc(N)c1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C21H22Cl2N4O3/c1-11(27(20(29)30)21(2,3)4)18-25-17-15(23)9-8-14(22)16(17)19(28)26(18)13-7-5-6-12(24)10-13/h5-11H,24H2,1-4H3,(H,29,30)/t11-/m0/s1 |
| InChIKey | QHRKTTDEBLFYRS-NSHDSACASA-N |
| XLogP | 5.11 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|