C25H29Cl2N5O5 — CID 118571830
tert-butyl-[1-[5,8-dichloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethyl]carbamic acid (PubChem CID 118571830) has the molecular formula C25H29Cl2N5O5 and a molecular weight of 550.44 g/mol. Its IUPAC name is tert-butyl-[1-[5,8-dichloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[5,8-dichloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 118571830 |
| Molecular Formula | C25H29Cl2N5O5 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | tert-butyl-[1-[5,8-dichloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
| SMILES | CC(c1nc2c(Cl)ccc(Cl)c2c(=O)n1-c1cccc(NC(=O)NCCCO)c1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C25H29Cl2N5O5/c1-14(32(24(36)37)25(2,3)4)21-30-20-18(27)10-9-17(26)19(20)22(34)31(21)16-8-5-7-15(13-16)29-23(35)28-11-6-12-33/h5,7-10,13-14,33H,6,11-12H2,1-4H3,(H,36,37)(H2,28,29,35) |
| InChIKey | AKZRIAIKFOLNPW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|