C21H22ClN5O5 — CID 139556655
1-[5-chloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethylcarbamic acid (PubChem CID 139556655) has the molecular formula C21H22ClN5O5 and a molecular weight of 459.89 g/mol. Its IUPAC name is 1-[5-chloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethylcarbamic acid.
| Compound Name | 1-[5-chloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 139556655 |
| Molecular Formula | C21H22ClN5O5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 1-[5-chloro-3-[3-(3-hydroxypropylcarbamoylamino)phenyl]-4-oxoquinazolin-2-yl]ethylcarbamic acid |
| SMILES | CC(NC(=O)O)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(NC(=O)NCCCO)c1 |
| InChI | InChI=1S/C21H22ClN5O5/c1-12(24-21(31)32)18-26-16-8-3-7-15(22)17(16)19(29)27(18)14-6-2-5-13(11-14)25-20(30)23-9-4-10-28/h2-3,5-8,11-12,24,28H,4,9-10H2,1H3,(H,31,32)(H2,23,25,30) |
| InChIKey | RBRHFAXPSKNMJU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|