C23H19Cl2N5O2 — CID 118571354
1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-chlorophenyl)urea (PubChem CID 118571354) has the molecular formula C23H19Cl2N5O2 and a molecular weight of 468.34 g/mol. Its IUPAC name is 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 118571354 |
| Molecular Formula | C23H19Cl2N5O2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-chlorophenyl)urea |
| SMILES | CC(N)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(NC(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H19Cl2N5O2/c1-13(26)21-28-19-11-5-9-17(25)20(19)22(31)30(21)15-7-4-6-14(12-15)27-23(32)29-18-10-3-2-8-16(18)24/h2-13H,26H2,1H3,(H2,27,29,32) |
| InChIKey | HADKHDSLEPQRFM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |