C24H22ClN5O3 — CID 118571493
1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-methoxyphenyl)urea (PubChem CID 118571493) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 118571493 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-[3-[2-(1-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]phenyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1cccc(-n2c(C(C)N)nc3cccc(Cl)c3c2=O)c1 |
| InChI | InChI=1S/C24H22ClN5O3/c1-14(26)22-28-19-11-6-9-17(25)21(19)23(31)30(22)16-8-5-7-15(13-16)27-24(32)29-18-10-3-4-12-20(18)33-2/h3-14H,26H2,1-2H3,(H2,27,29,32) |
| InChIKey | UBDAXMDKVAYMMT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |