C20H19ClFN3O3 — CID 90235469
[1-[5-chloro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]-3-methylbutyl]carbamic acid (PubChem CID 90235469) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is [1-[5-chloro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]-3-methylbutyl]carbamic acid.
| Compound Name | [1-[5-chloro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]-3-methylbutyl]carbamic acid |
|---|---|
| PubChem CID | 90235469 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [1-[5-chloro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]-3-methylbutyl]carbamic acid |
| SMILES | CC(C)CC(NC(=O)O)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H19ClFN3O3/c1-11(2)9-16(24-20(27)28)18-23-15-8-4-7-14(21)17(15)19(26)25(18)13-6-3-5-12(22)10-13/h3-8,10-11,16,24H,9H2,1-2H3,(H,27,28) |
| InChIKey | CIDVQOLWXQTATL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |