C18H14ClFN2O3 — CID 137463939
[(1S)-1-[8-chloro-2-(3-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]carbamic acid (PubChem CID 137463939) has the molecular formula C18H14ClFN2O3 and a molecular weight of 360.77 g/mol. Its IUPAC name is [(1S)-1-[8-chloro-2-(3-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]carbamic acid.
| Compound Name | [(1S)-1-[8-chloro-2-(3-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 137463939 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(1S)-1-[8-chloro-2-(3-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)c1cc2cccc(Cl)c2c(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H14ClFN2O3/c1-10(21-18(24)25)15-8-11-4-2-7-14(19)16(11)17(23)22(15)13-6-3-5-12(20)9-13/h2-10,21H,1H3,(H,24,25)/t10-/m0/s1 |
| InChIKey | LBENOSKCRUWBRP-JTQLQIEISA-N |
| XLogP | 4.11 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |