C20H22FN5O3 — CID 118571784
1-[3-[2-(1-aminoethyl)-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 118571784) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[3-[2-(1-aminoethyl)-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[3-[2-(1-aminoethyl)-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 118571784 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[3-[2-(1-aminoethyl)-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | CC(N)c1nc2c(F)cccc2c(=O)n1-c1cccc(NC(=O)NCCCO)c1 |
| InChI | InChI=1S/C20H22FN5O3/c1-12(22)18-25-17-15(7-3-8-16(17)21)19(28)26(18)14-6-2-5-13(11-14)24-20(29)23-9-4-10-27/h2-3,5-8,11-12,27H,4,9-10,22H2,1H3,(H2,23,24,29) |
| InChIKey | GNFSBOCCIPGTQR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|