C19H19F2N5O2 — CID 118571313
1-[3-[2-(1-aminoethyl)-5,8-difluoro-4-oxoquinazolin-3-yl]phenyl]-3-ethylurea (PubChem CID 118571313) has the molecular formula C19H19F2N5O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-[3-[2-(1-aminoethyl)-5,8-difluoro-4-oxoquinazolin-3-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[3-[2-(1-aminoethyl)-5,8-difluoro-4-oxoquinazolin-3-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 118571313 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[3-[2-(1-aminoethyl)-5,8-difluoro-4-oxoquinazolin-3-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cccc(-n2c(C(C)N)nc3c(F)ccc(F)c3c2=O)c1 |
| InChI | InChI=1S/C19H19F2N5O2/c1-3-23-19(28)24-11-5-4-6-12(9-11)26-17(10(2)22)25-16-14(21)8-7-13(20)15(16)18(26)27/h4-10H,3,22H2,1-2H3,(H2,23,24,28) |
| InChIKey | LKMWTXIAFBPQIO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |